136-53-8
| Name | Ethylhexanoic acid zinc salt |
| CAS | 136-53-8 |
| EINECS(EC#) | 205-251-1 |
| Molecular Formula | C16H30O4Zn |
| MDL Number | MFCD00053316 |
| Molecular Weight | 351.8 |
| MOL File | 136-53-8.mol |
Chemical Properties
| density | 1,17 g/cm3 |
| Fp | 40°C |
| storage temp. | Storage temp. 2-8°C |
| form | Liquid |
| Specific Gravity | 1.07 |
| Appearance | Colorless to light yellow Viscous Liquid |
| Water Solubility | Not miscible or difficult to mix in water. |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Exposure limits | ACGIH: TWA 100 ppm OSHA: TWA 500 ppm(2900 mg/m3) NIOSH: IDLH 20000 mg/m3; TWA 350 mg/m3; Ceiling 1800 mg/m3 |
| Cosmetics Ingredients Functions | DEODORANT |
| InChI | InChI=1S/2C8H16O2.Zn/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | IFNXAMCERSVZCV-UHFFFAOYSA-L |
| SMILES | C(CC)(CCCC)C(=O)O[Zn]OC(=O)C(CC)CCCC |
| CAS DataBase Reference | 136-53-8(CAS DataBase Reference) |
| EPA Substance Registry System | 136-53-8(EPA Substance) |
Safety Data
| Symbol(GHS) |   GHS02,GHS08 |
| Signal word | Warning |
| Hazard statements | H361-H226-H304-H340-H350-H372 |
| Precautionary statements | P210-P260-P301+P310a-P303+P361+P353-P405-P501a-P280h |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 1993 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 3 |
| PackingGroup | III |